1,1,3,3-TETRAETHOXYPROPANE (1,3-D2, 98%)
0.05 G
| Chemical purity | 98% |
| Reference | DLM-6109-0.05 |
| Unlabeled CAS Number | 122-31-6 |
| Labeled CAS Number | 105479-86-5 |
| Linear formula | CD(OCH2CH3)2CH2CD(OCH2CH3)2 |
| MW | 222,32 |
| Product Name | Item Number | Unit | Chemical purity | Linear formula | Price (excl. VAT) | Qty | |
|---|---|---|---|---|---|---|---|
| 1,1,3,3-TETRAETHOXYPROPANE (1,3-D2, 98%) | DLM-6109-0.1 | 0.1 G | 98% | CD(OCH2CH3)2CH2CD(OCH2CH3)2 | 1.330,00 € |
Add to my cart | |
| 1,1,3,3-TETRAETHOXYPROPANE (1,3-D2, 96-98%) 95% CP | DLM-6109-PK | 95% | CD(OCH2CH3)2CH2CD(OCH2CH3)2 | Request For Quote |
Add to my cart |
