L-CARNITINE:HCL, O-BUTYRYL (N-METHYL-D3, 98%) 97% CHEMICAL PURITY
G
| Chemical purity | 97% |
| Reference | DLM-3861-PK |
| Unlabeled CAS Number | 162067-50-7 |
| Labeled CAS Number | 1334532-21-6 |
| Linear formula | CD3N+(CH3)2CH2CH(OCO(CH2)2CH3)CH2COO-.HCl |
| MW | 270,77 |
| Manufacturer | Cambridge Isotope Laboratories |
| Product Name | Item Number | Unit | Chemical purity | Linear formula | Price (excl. VAT) | Qty | |
|---|---|---|---|---|---|---|---|
| L-CARNITINE:HCL, O-BUTYRYL (N-METHYL-D3, 98%) 97% CHEMICAL PURITY | DLM-3861-0.01 | 0.01 G | 97% | CD3N+(CH3)2CH2CH(OCO(CH2)2CH3)CH2COO-.HCl | 324,00 € |
Add to my cart |
