L-METHIONINE-N-FMOC (METHYL-13C, 99%)
G
| Chemical purity | 98% |
| Reference | CLM-1141-PK |
| Unlabeled CAS Number | 71989-28-1 |
| Labeled CAS Number | 2483735-39-1 |
| Linear formula | *CC19H21NO4S |
| MW | 372,44 |
| Product Name | Item Number | Unit | Chemical purity | Linear formula | Price (excl. VAT) | Qty | |
|---|---|---|---|---|---|---|---|
| L-METHIONINE-N-FMOC (METHYL-13C, 99%) | CLM-1141-1 | 1 G | 98% | *CH3SCH2CH2CH(NH-FMOC)COOH | 1.127,00 € |
Add to my cart |
