L-CARNITINE:HCL, O-OCTANOYL (N-METHYL-D3, 98%)
G
| Chemical purity | 98% |
| Reference | DLM-755-PK |
| Unlabeled CAS Number | 54377-02-5 |
| Labeled CAS Number | 1334532-24-9 |
| Linear formula | CD3N+(CH3)2CH2CH(OCO(CH2)6CH3)CH2COO-.HCl |
| MW | 326,87 |
| Manufacturer | Cambridge Isotope Laboratories |
| Product Name | Item Number | Unit | Chemical purity | Linear formula | Price (excl. VAT) | Qty | |
|---|---|---|---|---|---|---|---|
| L-CARNITINE:HCL, O-OCTANOYL (N-METHYL-D3, 98%) | DLM-755-0.01 | 0.01 G | 98% | CD3N+(CH3)2CH2CH(OCO(CH2)6CH3)CH2COO-.HCl | 345,00 € |
Add to my cart |
