L-ARGININE:HCL (GUANIDO-13C, 99%)
G
| Chemical purity | 98% |
| Reference | CLM-2070-PK |
| Unlabeled CAS Number | 1119-34-2 |
| Labeled CAS Number | 94740-43-9 |
| Linear formula | H2N*C(=NH)NH(CH2)3CH(NH2)COOH.HCl |
| MW | 211,65 |
| Manufacturer | Cambridge Isotope Laboratories |
| Product Name | Item Number | Unit | Chemical purity | Linear formula | Price (excl. VAT) | Qty | |
|---|---|---|---|---|---|---|---|
| L-ARGININE:HCL (GUANIDO-13C, 99%) | CLM-2070-0.5 | 0.5 G | 98% | H2N*C(=NH)NH(CH2)3CH(NH2)COOH. | 1.031,00 € |
Add to my cart |
